C18H13F7N2O3 — CID 43003740
N'-[2-(2-fluorophenoxy)propanoyl]-3,5-bis(trifluoromethyl)benzohydrazide (PubChem CID 43003740) has the molecular formula C18H13F7N2O3 and a molecular weight of 438.30 g/mol. Its IUPAC name is N'-[2-(2-fluorophenoxy)propanoyl]-3,5-bis(trifluoromethyl)benzohydrazide.
| Compound Name | N'-[2-(2-fluorophenoxy)propanoyl]-3,5-bis(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 43003740 |
| Molecular Formula | C18H13F7N2O3 |
| Molecular Weight | 438.30 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | N'-[2-(2-fluorophenoxy)propanoyl]-3,5-bis(trifluoromethyl)benzohydrazide |
| SMILES | CC(Oc1ccccc1F)C(=O)NNC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H13F7N2O3/c1-9(30-14-5-3-2-4-13(14)19)15(28)26-27-16(29)10-6-11(17(20,21)22)8-12(7-10)18(23,24)25/h2-9H,1H3,(H,26,28)(H,27,29) |
| InChIKey | CJYVYNDSDIVZDC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|