C17H17FN2O5S — CID 43003714
N'-[2-(2-fluorophenoxy)propanoyl]-4-methylsulfonylbenzohydrazide (PubChem CID 43003714) has the molecular formula C17H17FN2O5S and a molecular weight of 380.40 g/mol. Its IUPAC name is N'-[2-(2-fluorophenoxy)propanoyl]-4-methylsulfonylbenzohydrazide.
| Compound Name | N'-[2-(2-fluorophenoxy)propanoyl]-4-methylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 43003714 |
| Molecular Formula | C17H17FN2O5S |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | N'-[2-(2-fluorophenoxy)propanoyl]-4-methylsulfonylbenzohydrazide |
| SMILES | CC(Oc1ccccc1F)C(=O)NNC(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H17FN2O5S/c1-11(25-15-6-4-3-5-14(15)18)16(21)19-20-17(22)12-7-9-13(10-8-12)26(2,23)24/h3-11H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | YVSPZVHZFNXCOA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|