C17H21NO2 — CID 123307506
1-[1-(2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]butan-1-one (PubChem CID 123307506) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 1-[1-(2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]butan-1-one.
| Compound Name | 1-[1-(2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]butan-1-one |
|---|---|
| PubChem CID | 123307506 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 1-[1-(2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]butan-1-one |
| SMILES | CCCC(=O)c1cc(C)n(-c2ccccc2OC)c1C |
| InChI | InChI=1S/C17H21NO2/c1-5-8-16(19)14-11-12(2)18(13(14)3)15-9-6-7-10-17(15)20-4/h6-7,9-11H,5,8H2,1-4H3 |
| InChIKey | IRLQVVGCDUWHBM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|