C14H17NO2 — CID 39247985
[1-(2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methanol (PubChem CID 39247985) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is [1-(2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methanol.
| Compound Name | [1-(2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 39247985 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | [1-(2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methanol |
| SMILES | COc1ccccc1-n1c(C)cc(CO)c1C |
| InChI | InChI=1S/C14H17NO2/c1-10-8-12(9-16)11(2)15(10)13-6-4-5-7-14(13)17-3/h4-8,16H,9H2,1-3H3 |
| InChIKey | HRVLGIXGLGLWAT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|