C21H20FN2O2+ — CID 8830737
2-(3-acetylpyridin-1-ium-1-yl)-1-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 8830737) has the molecular formula C21H20FN2O2+ and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-(3-acetylpyridin-1-ium-1-yl)-1-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-(3-acetylpyridin-1-ium-1-yl)-1-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 8830737 |
| Molecular Formula | C21H20FN2O2+ |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 2-(3-acetylpyridin-1-ium-1-yl)-1-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | CC(=O)c1ccc[n+](CC(=O)c2cc(C)n(-c3ccccc3F)c2C)c1 |
| InChI | InChI=1S/C21H20FN2O2/c1-14-11-18(15(2)24(14)20-9-5-4-8-19(20)22)21(26)13-23-10-6-7-17(12-23)16(3)25/h4-12H,13H2,1-3H3/q+1 |
| InChIKey | FVYGIOHQOPRNSW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 42.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|