C24H21FN2OS — CID 4842647
1-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(4-methylquinolin-2-yl)sulfanylethanone (PubChem CID 4842647) has the molecular formula C24H21FN2OS and a molecular weight of 404.51 g/mol. Its IUPAC name is 1-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(4-methylquinolin-2-yl)sulfanylethanone.
| Compound Name | 1-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(4-methylquinolin-2-yl)sulfanylethanone |
|---|---|
| PubChem CID | 4842647 |
| Molecular Formula | C24H21FN2OS |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 1-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(4-methylquinolin-2-yl)sulfanylethanone |
| SMILES | Cc1cc(SCC(=O)c2cc(C)n(-c3ccccc3F)c2C)nc2ccccc12 |
| InChI | InChI=1S/C24H21FN2OS/c1-15-12-24(26-21-10-6-4-8-18(15)21)29-14-23(28)19-13-16(2)27(17(19)3)22-11-7-5-9-20(22)25/h4-13H,14H2,1-3H3 |
| InChIKey | OEWZPKXKEWIHON-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|