C18H14F2N2OS — CID 3948917
N-(2,4-difluorophenyl)-2-(4-methylquinolin-2-yl)sulfanylacetamide (PubChem CID 3948917) has the molecular formula C18H14F2N2OS and a molecular weight of 344.39 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(4-methylquinolin-2-yl)sulfanylacetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(4-methylquinolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 3948917 |
| Molecular Formula | C18H14F2N2OS |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(4-methylquinolin-2-yl)sulfanylacetamide |
| SMILES | Cc1cc(SCC(=O)Nc2ccc(F)cc2F)nc2ccccc12 |
| InChI | InChI=1S/C18H14F2N2OS/c1-11-8-18(22-15-5-3-2-4-13(11)15)24-10-17(23)21-16-7-6-12(19)9-14(16)20/h2-9H,10H2,1H3,(H,21,23) |
| InChIKey | UNSDOPUWHAHHKB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |