C19H15N3OS2 — CID 39765940
N-(1,3-benzothiazol-2-yl)-2-(4-methylquinolin-2-yl)sulfanylacetamide (PubChem CID 39765940) has the molecular formula C19H15N3OS2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-(4-methylquinolin-2-yl)sulfanylacetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-(4-methylquinolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 39765940 |
| Molecular Formula | C19H15N3OS2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-(4-methylquinolin-2-yl)sulfanylacetamide |
| SMILES | Cc1cc(SCC(=O)Nc2nc3ccccc3s2)nc2ccccc12 |
| InChI | InChI=1S/C19H15N3OS2/c1-12-10-18(20-14-7-3-2-6-13(12)14)24-11-17(23)22-19-21-15-8-4-5-9-16(15)25-19/h2-10H,11H2,1H3,(H,21,22,23) |
| InChIKey | CSMLHSPJSGNMFS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |