C19H16N2O3S — CID 22695352
4-[[2-(4-methylquinolin-2-yl)sulfanylacetyl]amino]benzoic acid (PubChem CID 22695352) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is 4-[[2-(4-methylquinolin-2-yl)sulfanylacetyl]amino]benzoic acid.
| Compound Name | 4-[[2-(4-methylquinolin-2-yl)sulfanylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 22695352 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 4-[[2-(4-methylquinolin-2-yl)sulfanylacetyl]amino]benzoic acid |
| SMILES | Cc1cc(SCC(=O)Nc2ccc(C(=O)O)cc2)nc2ccccc12 |
| InChI | InChI=1S/C19H16N2O3S/c1-12-10-18(21-16-5-3-2-4-15(12)16)25-11-17(22)20-14-8-6-13(7-9-14)19(23)24/h2-10H,11H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | QBWLCEADQZCILH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |