C18H15FN2OS — CID 755909
N-(2-fluorophenyl)-2-(4-methylquinolin-2-yl)sulfanylacetamide (PubChem CID 755909) has the molecular formula C18H15FN2OS and a molecular weight of 326.40 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-(4-methylquinolin-2-yl)sulfanylacetamide.
| Compound Name | N-(2-fluorophenyl)-2-(4-methylquinolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 755909 |
| Molecular Formula | C18H15FN2OS |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-(2-fluorophenyl)-2-(4-methylquinolin-2-yl)sulfanylacetamide |
| SMILES | Cc1cc(SCC(=O)Nc2ccccc2F)nc2ccccc12 |
| InChI | InChI=1S/C18H15FN2OS/c1-12-10-18(21-15-8-4-2-6-13(12)15)23-11-17(22)20-16-9-5-3-7-14(16)19/h2-10H,11H2,1H3,(H,20,22) |
| InChIKey | TTZHDAUXQBPFCZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |