C18H14Cl2N2OS — CID 9107262
N-(2,6-dichlorophenyl)-2-(4-methylquinolin-2-yl)sulfanylacetamide (PubChem CID 9107262) has the molecular formula C18H14Cl2N2OS and a molecular weight of 377.30 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-(4-methylquinolin-2-yl)sulfanylacetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-(4-methylquinolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 9107262 |
| Molecular Formula | C18H14Cl2N2OS |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-(4-methylquinolin-2-yl)sulfanylacetamide |
| SMILES | Cc1cc(SCC(=O)Nc2c(Cl)cccc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C18H14Cl2N2OS/c1-11-9-17(21-15-8-3-2-5-12(11)15)24-10-16(23)22-18-13(19)6-4-7-14(18)20/h2-9H,10H2,1H3,(H,22,23) |
| InChIKey | KKUFAAAAXTYGDL-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |