C11H9N5OS2 — CID 6411115
N-(1,3-benzothiazol-2-yl)-2-(2H-triazol-4-ylsulfanyl)acetamide (PubChem CID 6411115) has the molecular formula C11H9N5OS2 and a molecular weight of 291.36 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-(2H-triazol-4-ylsulfanyl)acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-(2H-triazol-4-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 6411115 |
| Molecular Formula | C11H9N5OS2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-(2H-triazol-4-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1cn[nH]n1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H9N5OS2/c17-9(6-18-10-5-12-16-15-10)14-11-13-7-3-1-2-4-8(7)19-11/h1-5H,6H2,(H,12,15,16)(H,13,14,17) |
| InChIKey | ZFKLDMPOYSULTN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |