C15H14N4O3S2 — CID 3997242
N-(1,3-benzothiazol-2-yl)-2-[(5-ethyl-4,6-dioxo-1H-pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 3997242) has the molecular formula C15H14N4O3S2 and a molecular weight of 362.44 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-[(5-ethyl-4,6-dioxo-1H-pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-[(5-ethyl-4,6-dioxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 3997242 |
| Molecular Formula | C15H14N4O3S2 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-[(5-ethyl-4,6-dioxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | CCC1C(=O)N=C(SCC(=O)Nc2nc3ccccc3s2)NC1=O |
| InChI | InChI=1S/C15H14N4O3S2/c1-2-8-12(21)18-14(19-13(8)22)23-7-11(20)17-15-16-9-5-3-4-6-10(9)24-15/h3-6,8H,2,7H2,1H3,(H,16,17,20)(H,18,19,21,22) |
| InChIKey | JPNGUJNPFXFWDV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|