C17H14N6OS3 — CID 73254490
N-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-(2H-triazol-4-ylsulfanyl)acetamide (PubChem CID 73254490) has the molecular formula C17H14N6OS3 and a molecular weight of 414.54 g/mol. Its IUPAC name is N-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-(2H-triazol-4-ylsulfanyl)acetamide.
| Compound Name | N-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-(2H-triazol-4-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 73254490 |
| Molecular Formula | C17H14N6OS3 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | N-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-(2H-triazol-4-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1cn[nH]n1)Nc1nnc(SCc2cccc3ccccc23)s1 |
| InChI | InChI=1S/C17H14N6OS3/c24-14(10-25-15-8-18-23-20-15)19-16-21-22-17(27-16)26-9-12-6-3-5-11-4-1-2-7-13(11)12/h1-8H,9-10H2,(H,18,20,23)(H,19,21,24) |
| InChIKey | NJBBSXJCRVWUES-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|