C19H16N6O2S3 — CID 135636112
2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 135636112) has the molecular formula C19H16N6O2S3 and a molecular weight of 456.58 g/mol. Its IUPAC name is 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 135636112 |
| Molecular Formula | C19H16N6O2S3 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | Nc1cc(=O)[nH]c(SCC(=O)Nc2nnc(SCc3cccc4ccccc34)s2)n1 |
| InChI | InChI=1S/C19H16N6O2S3/c20-14-8-15(26)22-17(21-14)28-10-16(27)23-18-24-25-19(30-18)29-9-12-6-3-5-11-4-1-2-7-13(11)12/h1-8H,9-10H2,(H,23,24,27)(H3,20,21,22,26) |
| InChIKey | KRUHVMRBUJMWCW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|