C12H14N6O4S3 — CID 137025257
ethyl 2-[[5-[[2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 137025257) has the molecular formula C12H14N6O4S3 and a molecular weight of 402.48 g/mol. Its IUPAC name is ethyl 2-[[5-[[2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 137025257 |
| Molecular Formula | C12H14N6O4S3 |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | ethyl 2-[[5-[[2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)CSc2nc(N)cc(=O)[nH]2)s1 |
| InChI | InChI=1S/C12H14N6O4S3/c1-2-22-9(21)5-24-12-18-17-11(25-12)16-8(20)4-23-10-14-6(13)3-7(19)15-10/h3H,2,4-5H2,1H3,(H,16,17,20)(H3,13,14,15,19) |
| InChIKey | BUDCPXGPADCANG-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 152.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|