C17H18N4O3S2 — CID 36583044
ethyl 2-[[5-[[2-(2-methylindol-1-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 36583044) has the molecular formula C17H18N4O3S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is ethyl 2-[[5-[[2-(2-methylindol-1-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[2-(2-methylindol-1-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 36583044 |
| Molecular Formula | C17H18N4O3S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | ethyl 2-[[5-[[2-(2-methylindol-1-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)Cn2c(C)cc3ccccc32)s1 |
| InChI | InChI=1S/C17H18N4O3S2/c1-3-24-15(23)10-25-17-20-19-16(26-17)18-14(22)9-21-11(2)8-12-6-4-5-7-13(12)21/h4-8H,3,9-10H2,1-2H3,(H,18,19,22) |
| InChIKey | HHIWOMLQVIOKJI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|