C21H18N6O3S2 — CID 55336813
ethyl 2-[[5-[(1,5-diphenyl-1,2,4-triazole-3-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 55336813) has the molecular formula C21H18N6O3S2 and a molecular weight of 466.55 g/mol. Its IUPAC name is ethyl 2-[[5-[(1,5-diphenyl-1,2,4-triazole-3-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[(1,5-diphenyl-1,2,4-triazole-3-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 55336813 |
| Molecular Formula | C21H18N6O3S2 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | ethyl 2-[[5-[(1,5-diphenyl-1,2,4-triazole-3-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)c2nc(-c3ccccc3)n(-c3ccccc3)n2)s1 |
| InChI | InChI=1S/C21H18N6O3S2/c1-2-30-16(28)13-31-21-25-24-20(32-21)23-19(29)17-22-18(14-9-5-3-6-10-14)27(26-17)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3,(H,23,24,29) |
| InChIKey | BIVCYBLEBBLXHK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|