C21H22N4O3 — CID 37258916
ethyl 4-[(1,5-diphenyl-1,2,4-triazole-3-carbonyl)amino]butanoate (PubChem CID 37258916) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is ethyl 4-[(1,5-diphenyl-1,2,4-triazole-3-carbonyl)amino]butanoate.
| Compound Name | ethyl 4-[(1,5-diphenyl-1,2,4-triazole-3-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 37258916 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | ethyl 4-[(1,5-diphenyl-1,2,4-triazole-3-carbonyl)amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)c1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H22N4O3/c1-2-28-18(26)14-9-15-22-21(27)19-23-20(16-10-5-3-6-11-16)25(24-19)17-12-7-4-8-13-17/h3-8,10-13H,2,9,14-15H2,1H3,(H,22,27) |
| InChIKey | QDHIPZYLERMLNY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|