C24H30N6O — CID 60553494
N-[3-(4-ethylpiperazin-1-yl)propyl]-1,5-diphenyl-1,2,4-triazole-3-carboxamide (PubChem CID 60553494) has the molecular formula C24H30N6O and a molecular weight of 418.55 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)propyl]-1,5-diphenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 60553494 |
| Molecular Formula | C24H30N6O |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
| SMILES | CCN1CCN(CCCNC(=O)c2nc(-c3ccccc3)n(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C24H30N6O/c1-2-28-16-18-29(19-17-28)15-9-14-25-24(31)22-26-23(20-10-5-3-6-11-20)30(27-22)21-12-7-4-8-13-21/h3-8,10-13H,2,9,14-19H2,1H3,(H,25,31) |
| InChIKey | FQNYOFTVVGIWGJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|