C25H29N5O2 — CID 38447789
6-methyl-4-oxo-1-phenyl-N-[3-(4-phenylpiperazin-1-yl)propyl]pyridazine-3-carboxamide (PubChem CID 38447789) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 6-methyl-4-oxo-1-phenyl-N-[3-(4-phenylpiperazin-1-yl)propyl]pyridazine-3-carboxamide.
| Compound Name | 6-methyl-4-oxo-1-phenyl-N-[3-(4-phenylpiperazin-1-yl)propyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 38447789 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 6-methyl-4-oxo-1-phenyl-N-[3-(4-phenylpiperazin-1-yl)propyl]pyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)NCCCN2CCN(c3ccccc3)CC2)nn1-c1ccccc1 |
| InChI | InChI=1S/C25H29N5O2/c1-20-19-23(31)24(27-30(20)22-11-6-3-7-12-22)25(32)26-13-8-14-28-15-17-29(18-16-28)21-9-4-2-5-10-21/h2-7,9-12,19H,8,13-18H2,1H3,(H,26,32) |
| InChIKey | WFPFDBDZJRLZNM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|