C18H17N3O3 — CID 17448047
N-[2-(furan-2-yl)ethyl]-6-methyl-4-oxo-1-phenylpyridazine-3-carboxamide (PubChem CID 17448047) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-6-methyl-4-oxo-1-phenylpyridazine-3-carboxamide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-6-methyl-4-oxo-1-phenylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 17448047 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-6-methyl-4-oxo-1-phenylpyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)NCCc2ccco2)nn1-c1ccccc1 |
| InChI | InChI=1S/C18H17N3O3/c1-13-12-16(22)17(20-21(13)14-6-3-2-4-7-14)18(23)19-10-9-15-8-5-11-24-15/h2-8,11-12H,9-10H2,1H3,(H,19,23) |
| InChIKey | BJZHDHMQSFNOLC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |