C19H25N3O3 — CID 111115964
N-(3-ethyl-2-hydroxypentyl)-6-methyl-4-oxo-1-phenylpyridazine-3-carboxamide (PubChem CID 111115964) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-(3-ethyl-2-hydroxypentyl)-6-methyl-4-oxo-1-phenylpyridazine-3-carboxamide.
| Compound Name | N-(3-ethyl-2-hydroxypentyl)-6-methyl-4-oxo-1-phenylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 111115964 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-(3-ethyl-2-hydroxypentyl)-6-methyl-4-oxo-1-phenylpyridazine-3-carboxamide |
| SMILES | CCC(CC)C(O)CNC(=O)c1nn(-c2ccccc2)c(C)cc1=O |
| InChI | InChI=1S/C19H25N3O3/c1-4-14(5-2)17(24)12-20-19(25)18-16(23)11-13(3)22(21-18)15-9-7-6-8-10-15/h6-11,14,17,24H,4-5,12H2,1-3H3,(H,20,25) |
| InChIKey | DCLANNQAFZLVRZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |