C21H25N5O3S — CID 52718659
N-[3-[ethyl(methylsulfonyl)amino]propyl]-1,5-diphenyl-1,2,4-triazole-3-carboxamide (PubChem CID 52718659) has the molecular formula C21H25N5O3S and a molecular weight of 427.53 g/mol. Its IUPAC name is N-[3-[ethyl(methylsulfonyl)amino]propyl]-1,5-diphenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 52718659 |
| Molecular Formula | C21H25N5O3S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
| SMILES | CCN(CCCNC(=O)c1nc(-c2ccccc2)n(-c2ccccc2)n1)S(C)(=O)=O |
| InChI | InChI=1S/C21H25N5O3S/c1-3-25(30(2,28)29)16-10-15-22-21(27)19-23-20(17-11-6-4-7-12-17)26(24-19)18-13-8-5-9-14-18/h4-9,11-14H,3,10,15-16H2,1-2H3,(H,22,27) |
| InChIKey | FGGRSDNMBLZLHQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|