C18H25ClN4O3S — CID 60552295
4-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[3-[ethyl(methylsulfonyl)amino]propyl]benzamide (PubChem CID 60552295) has the molecular formula C18H25ClN4O3S and a molecular weight of 412.94 g/mol. Its IUPAC name is 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[3-[ethyl(methylsulfonyl)amino]propyl]benzamide.
| Compound Name | 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[3-[ethyl(methylsulfonyl)amino]propyl]benzamide |
|---|---|
| PubChem CID | 60552295 |
| Molecular Formula | C18H25ClN4O3S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[3-[ethyl(methylsulfonyl)amino]propyl]benzamide |
| SMILES | CCN(CCCNC(=O)c1ccc(-n2nc(C)c(Cl)c2C)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C18H25ClN4O3S/c1-5-22(27(4,25)26)12-6-11-20-18(24)15-7-9-16(10-8-15)23-14(3)17(19)13(2)21-23/h7-10H,5-6,11-12H2,1-4H3,(H,20,24) |
| InChIKey | OPALPWVNCLTBFW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|