C16H20Cl2N4O3S — CID 60521372
N-[3-[[5-chloro-1-(4-chlorophenyl)-6-oxopyridazin-4-yl]amino]propyl]-N-ethylmethanesulfonamide (PubChem CID 60521372) has the molecular formula C16H20Cl2N4O3S and a molecular weight of 419.33 g/mol. Its IUPAC name is N-[3-[[5-chloro-1-(4-chlorophenyl)-6-oxopyridazin-4-yl]amino]propyl]-N-ethylmethanesulfonamide.
| Compound Name | N-[3-[[5-chloro-1-(4-chlorophenyl)-6-oxopyridazin-4-yl]amino]propyl]-N-ethylmethanesulfonamide |
|---|---|
| PubChem CID | 60521372 |
| Molecular Formula | C16H20Cl2N4O3S |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | N-[3-[[5-chloro-1-(4-chlorophenyl)-6-oxopyridazin-4-yl]amino]propyl]-N-ethylmethanesulfonamide |
| SMILES | CCN(CCCNc1cnn(-c2ccc(Cl)cc2)c(=O)c1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C16H20Cl2N4O3S/c1-3-21(26(2,24)25)10-4-9-19-14-11-20-22(16(23)15(14)18)13-7-5-12(17)6-8-13/h5-8,11,19H,3-4,9-10H2,1-2H3 |
| InChIKey | ALDCRQAFBNHYSI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|