C15H15Cl2N3O2 — CID 94415319
4-chloro-2-(4-chlorophenyl)-5-[[(3S)-oxolan-3-yl]methylamino]pyridazin-3-one (PubChem CID 94415319) has the molecular formula C15H15Cl2N3O2 and a molecular weight of 340.21 g/mol. Its IUPAC name is 4-chloro-2-(4-chlorophenyl)-5-[[(3S)-oxolan-3-yl]methylamino]pyridazin-3-one.
| Compound Name | 4-chloro-2-(4-chlorophenyl)-5-[[(3S)-oxolan-3-yl]methylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 94415319 |
| Molecular Formula | C15H15Cl2N3O2 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 4-chloro-2-(4-chlorophenyl)-5-[[(3S)-oxolan-3-yl]methylamino]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NC[C@@H]2CCOC2)cnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H15Cl2N3O2/c16-11-1-3-12(4-2-11)20-15(21)14(17)13(8-19-20)18-7-10-5-6-22-9-10/h1-4,8,10,18H,5-7,9H2/t10-/m0/s1 |
| InChIKey | KSEDGTOSPXQNCN-JTQLQIEISA-N |
| XLogP | 2.99 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |