About 4-chloro-5-(oxan-3-ylmethylamino)-2-phenylpyridazin-3-one;2-cyclopropyloxolane
4-chloro-5-(oxan-3-ylmethylamino)-2-phenylpyridazin-3-one;2-cyclopropyloxolane (PubChem CID 168964040) has the molecular formula C23H30ClN3O3
and a molecular weight of 431.96 g/mol. Its IUPAC name is 4-chloro-5-(oxan-3-ylmethylamino)-2-phenylpyridazin-3-one;2-cyclopropyloxolane.
Molecular Properties
| Compound Name | 4-chloro-5-(oxan-3-ylmethylamino)-2-phenylpyridazin-3-one;2-cyclopropyloxolane |
| PubChem CID | 168964040 |
| Molecular Formula | C23H30ClN3O3 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 4-chloro-5-(oxan-3-ylmethylamino)-2-phenylpyridazin-3-one;2-cyclopropyloxolane |
| SMILES | C1COC(C2CC2)C1.O=c1c(Cl)c(NCC2CCCOC2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C16H18ClN3O2.C7H12O/c17-15-14(18-9-12-5-4-8-22-11-12)10-19-20(16(15)21)13-6-2-1-3-7-13;1-2-7(8-5-1)6-3-4-6/h1-3,6-7,10,12,18H,4-5,8-9,11H2;6-7H,1-5H2 |
| InChIKey | ZWNSBDGXPIXSFK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-chloro-5-(oxan-3-ylmethylamino)-2-phenylpyridazin-3-one;2-cyclopropyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-(oxan-3-ylmethylamino)-2-phenylpyridazin-3-one;2-cyclopropyloxolane?
The IUPAC name of 4-chloro-5-(oxan-3-ylmethylamino)-2-phenylpyridazin-3-one;2-cyclopropyloxolane (CID 168964040) is 4-chloro-5-(oxan-3-ylmethylamino)-2-phenylpyridazin-3-one;2-cyclopropyloxolane.
What is the SMILES notation for 4-chloro-5-(oxan-3-ylmethylamino)-2-phenylpyridazin-3-one;2-cyclopropyloxolane?
The canonical SMILES for 4-chloro-5-(oxan-3-ylmethylamino)-2-phenylpyridazin-3-one;2-cyclopropyloxolane is C1COC(C2CC2)C1.O=c1c(Cl)c(NCC2CCCOC2)cnn1-c1ccccc1.
What is the InChIKey of 4-chloro-5-(oxan-3-ylmethylamino)-2-phenylpyridazin-3-one;2-cyclopropyloxolane?
The InChIKey is ZWNSBDGXPIXSFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClN3O2.C7H12O/c17-15-14(18-9-12-5-4-8-22-11-12)10-19-20(16(15)21)13-6-2-1-3-7-13;1-2-7(8-5-1)6-3-4-6/h1-3,6-7,10,12,18H,4-5,8-9,11H2;6-7H,1-5H2.
What are the key properties of 4-chloro-5-(oxan-3-ylmethylamino)-2-phenylpyridazin-3-one;2-cyclopropyloxolane?
4-chloro-5-(oxan-3-ylmethylamino)-2-phenylpyridazin-3-one;2-cyclopropyloxolane has a molecular weight of 431.96 g/mol, XLogP of 4.30, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-(oxan-3-ylmethylamino)-2-phenylpyridazin-3-one;2-cyclopropyloxolane is sourced from PubChem (CID 168964040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).