C21H21ClN4O3 — CID 168963557
4-chloro-5-[[(3S)-oxan-3-yl]methylamino]-2-(4-pyridin-3-yloxyphenyl)pyridazin-3-one (PubChem CID 168963557) has the molecular formula C21H21ClN4O3 and a molecular weight of 412.88 g/mol. Its IUPAC name is 4-chloro-5-[[(3S)-oxan-3-yl]methylamino]-2-(4-pyridin-3-yloxyphenyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[[(3S)-oxan-3-yl]methylamino]-2-(4-pyridin-3-yloxyphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 168963557 |
| Molecular Formula | C21H21ClN4O3 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 4-chloro-5-[[(3S)-oxan-3-yl]methylamino]-2-(4-pyridin-3-yloxyphenyl)pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NC[C@@H]2CCCOC2)cnn1-c1ccc(Oc2cccnc2)cc1 |
| InChI | InChI=1S/C21H21ClN4O3/c22-20-19(24-11-15-3-2-10-28-14-15)13-25-26(21(20)27)16-5-7-17(8-6-16)29-18-4-1-9-23-12-18/h1,4-9,12-13,15,24H,2-3,10-11,14H2/t15-/m0/s1 |
| InChIKey | OXMSZMDFPNKVNX-HNNXBMFYSA-N |
| XLogP | 3.91 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |