C21H28BClIN3O4S — CID 168964622
4-chloro-2-(4-cyclobutyloxyphenyl)-5-(oxan-3-ylmethylamino)pyridazin-3-one;iodo(methylsulfanyl)borinic acid (PubChem CID 168964622) has the molecular formula C21H28BClIN3O4S and a molecular weight of 591.71 g/mol. Its IUPAC name is 4-chloro-2-(4-cyclobutyloxyphenyl)-5-(oxan-3-ylmethylamino)pyridazin-3-one;iodo(methylsulfanyl)borinic acid.
| Compound Name | 4-chloro-2-(4-cyclobutyloxyphenyl)-5-(oxan-3-ylmethylamino)pyridazin-3-one;iodo(methylsulfanyl)borinic acid |
|---|---|
| PubChem CID | 168964622 |
| Molecular Formula | C21H28BClIN3O4S |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.06 |
| IUPAC Name | 4-chloro-2-(4-cyclobutyloxyphenyl)-5-(oxan-3-ylmethylamino)pyridazin-3-one;iodo(methylsulfanyl)borinic acid |
| SMILES | CSB(O)I.O=c1c(Cl)c(NCC2CCCOC2)cnn1-c1ccc(OC2CCC2)cc1 |
| InChI | InChI=1S/C20H24ClN3O3.CH4BIOS/c21-19-18(22-11-14-3-2-10-26-13-14)12-23-24(20(19)25)15-6-8-17(9-7-15)27-16-4-1-5-16;1-5-2(3)4/h6-9,12,14,16,22H,1-5,10-11,13H2;4H,1H3 |
| InChIKey | XNJMSUGOSZBMIM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|