C25H27ClN4O4 — CID 168963431
[4-[4-[5-chloro-4-[[(3S)-oxan-3-yl]methylamino]-6-oxopyridazin-1-yl]-N-methylanilino]phenyl] acetate (PubChem CID 168963431) has the molecular formula C25H27ClN4O4 and a molecular weight of 482.97 g/mol. Its IUPAC name is [4-[4-[5-chloro-4-[[(3S)-oxan-3-yl]methylamino]-6-oxopyridazin-1-yl]-N-methylanilino]phenyl] acetate.
| Compound Name | [4-[4-[5-chloro-4-[[(3S)-oxan-3-yl]methylamino]-6-oxopyridazin-1-yl]-N-methylanilino]phenyl] acetate |
|---|---|
| PubChem CID | 168963431 |
| Molecular Formula | C25H27ClN4O4 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | [4-[4-[5-chloro-4-[[(3S)-oxan-3-yl]methylamino]-6-oxopyridazin-1-yl]-N-methylanilino]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N(C)c2ccc(-n3ncc(NC[C@@H]4CCCOC4)c(Cl)c3=O)cc2)cc1 |
| InChI | InChI=1S/C25H27ClN4O4/c1-17(31)34-22-11-9-20(10-12-22)29(2)19-5-7-21(8-6-19)30-25(32)24(26)23(15-28-30)27-14-18-4-3-13-33-16-18/h5-12,15,18,27H,3-4,13-14,16H2,1-2H3/t18-/m0/s1 |
| InChIKey | TYGXNFWKGVQPQA-SFHVURJKSA-N |
| XLogP | 4.42 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|