C17H17ClF3N3O2 — CID 168963829
4-chloro-5-[[(3R)-oxan-3-yl]methylamino]-2-[4-(trifluoromethyl)phenyl]pyridazin-3-one (PubChem CID 168963829) has the molecular formula C17H17ClF3N3O2 and a molecular weight of 387.79 g/mol. Its IUPAC name is 4-chloro-5-[[(3R)-oxan-3-yl]methylamino]-2-[4-(trifluoromethyl)phenyl]pyridazin-3-one.
| Compound Name | 4-chloro-5-[[(3R)-oxan-3-yl]methylamino]-2-[4-(trifluoromethyl)phenyl]pyridazin-3-one |
|---|---|
| PubChem CID | 168963829 |
| Molecular Formula | C17H17ClF3N3O2 |
| Molecular Weight | 387.79 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 4-chloro-5-[[(3R)-oxan-3-yl]methylamino]-2-[4-(trifluoromethyl)phenyl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NC[C@H]2CCCOC2)cnn1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H17ClF3N3O2/c18-15-14(22-8-11-2-1-7-26-10-11)9-23-24(16(15)25)13-5-3-12(4-6-13)17(19,20)21/h3-6,9,11,22H,1-2,7-8,10H2/t11-/m1/s1 |
| InChIKey | WOAPOJBVNNHIEF-LLVKDONJSA-N |
| XLogP | 3.74 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.79 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |