C23H23ClF3N5O3S — CID 168963669
4-chloro-2-[6-[N-methyl-4-(trifluoromethoxy)anilino]sulfanyl-3-pyridinyl]-5-(oxan-3-ylmethylamino)pyridazin-3-one (PubChem CID 168963669) has the molecular formula C23H23ClF3N5O3S and a molecular weight of 541.98 g/mol. Its IUPAC name is 4-chloro-2-[6-[N-methyl-4-(trifluoromethoxy)anilino]sulfanyl-3-pyridinyl]-5-(oxan-3-ylmethylamino)pyridazin-3-one.
| Compound Name | 4-chloro-2-[6-[N-methyl-4-(trifluoromethoxy)anilino]sulfanyl-3-pyridinyl]-5-(oxan-3-ylmethylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 168963669 |
| Molecular Formula | C23H23ClF3N5O3S |
| Molecular Weight | 541.98 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | 4-chloro-2-[6-[N-methyl-4-(trifluoromethoxy)anilino]sulfanyl-3-pyridinyl]-5-(oxan-3-ylmethylamino)pyridazin-3-one |
| SMILES | CN(Sc1ccc(-n2ncc(NCC3CCCOC3)c(Cl)c2=O)cn1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H23ClF3N5O3S/c1-31(16-4-7-18(8-5-16)35-23(25,26)27)36-20-9-6-17(12-29-20)32-22(33)21(24)19(13-30-32)28-11-15-3-2-10-34-14-15/h4-9,12-13,15,28H,2-3,10-11,14H2,1H3 |
| InChIKey | SUIOGAMVJWCEJN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.98 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|