C25H34ClN5O3S — CID 168963683
4-chloro-5-(oxan-3-ylmethylamino)-2-[4-(1-pyrrolidin-1-ylsulfanylpiperidin-4-yl)oxyphenyl]pyridazin-3-one (PubChem CID 168963683) has the molecular formula C25H34ClN5O3S and a molecular weight of 520.10 g/mol. Its IUPAC name is 4-chloro-5-(oxan-3-ylmethylamino)-2-[4-(1-pyrrolidin-1-ylsulfanylpiperidin-4-yl)oxyphenyl]pyridazin-3-one.
| Compound Name | 4-chloro-5-(oxan-3-ylmethylamino)-2-[4-(1-pyrrolidin-1-ylsulfanylpiperidin-4-yl)oxyphenyl]pyridazin-3-one |
|---|---|
| PubChem CID | 168963683 |
| Molecular Formula | C25H34ClN5O3S |
| Molecular Weight | 520.10 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | 4-chloro-5-(oxan-3-ylmethylamino)-2-[4-(1-pyrrolidin-1-ylsulfanylpiperidin-4-yl)oxyphenyl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NCC2CCCOC2)cnn1-c1ccc(OC2CCN(SN3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C25H34ClN5O3S/c26-24-23(27-16-19-4-3-15-33-18-19)17-28-31(25(24)32)20-5-7-21(8-6-20)34-22-9-13-30(14-10-22)35-29-11-1-2-12-29/h5-8,17,19,22,27H,1-4,9-16,18H2 |
| InChIKey | IYKGIZIABDCVCJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.10 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|