C21H27ClN4O2 — CID 168963423
4-chloro-5-[[(3S)-oxan-3-yl]methylamino]-2-(1-phenylpiperidin-4-yl)pyridazin-3-one (PubChem CID 168963423) has the molecular formula C21H27ClN4O2 and a molecular weight of 402.93 g/mol. Its IUPAC name is 4-chloro-5-[[(3S)-oxan-3-yl]methylamino]-2-(1-phenylpiperidin-4-yl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[[(3S)-oxan-3-yl]methylamino]-2-(1-phenylpiperidin-4-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 168963423 |
| Molecular Formula | C21H27ClN4O2 |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 4-chloro-5-[[(3S)-oxan-3-yl]methylamino]-2-(1-phenylpiperidin-4-yl)pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NC[C@@H]2CCCOC2)cnn1C1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H27ClN4O2/c22-20-19(23-13-16-5-4-12-28-15-16)14-24-26(21(20)27)18-8-10-25(11-9-18)17-6-2-1-3-7-17/h1-3,6-7,14,16,18,23H,4-5,8-13,15H2/t16-/m0/s1 |
| InChIKey | VIZXKDFRAIGJBH-INIZCTEOSA-N |
| XLogP | 3.58 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |