C22H28ClN5O3S — CID 168963125
4-[4-[5-chloro-4-(oxan-3-ylmethylamino)-6-oxopyridazin-1-yl]piperidin-1-yl]sulfanylbenzamide (PubChem CID 168963125) has the molecular formula C22H28ClN5O3S and a molecular weight of 478.02 g/mol. Its IUPAC name is 4-[4-[5-chloro-4-(oxan-3-ylmethylamino)-6-oxopyridazin-1-yl]piperidin-1-yl]sulfanylbenzamide.
| Compound Name | 4-[4-[5-chloro-4-(oxan-3-ylmethylamino)-6-oxopyridazin-1-yl]piperidin-1-yl]sulfanylbenzamide |
|---|---|
| PubChem CID | 168963125 |
| Molecular Formula | C22H28ClN5O3S |
| Molecular Weight | 478.02 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 4-[4-[5-chloro-4-(oxan-3-ylmethylamino)-6-oxopyridazin-1-yl]piperidin-1-yl]sulfanylbenzamide |
| SMILES | NC(=O)c1ccc(SN2CCC(n3ncc(NCC4CCCOC4)c(Cl)c3=O)CC2)cc1 |
| InChI | InChI=1S/C22H28ClN5O3S/c23-20-19(25-12-15-2-1-11-31-14-15)13-26-28(22(20)30)17-7-9-27(10-8-17)32-18-5-3-16(4-6-18)21(24)29/h3-6,13,15,17,25H,1-2,7-12,14H2,(H2,24,29) |
| InChIKey | ZPUXUKDRMLIZIG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.02 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|