C23H28ClN5O2S — CID 168963473
4-chloro-2-[1-(1H-indol-5-ylsulfanyl)piperidin-4-yl]-5-(oxan-3-ylmethylamino)pyridazin-3-one (PubChem CID 168963473) has the molecular formula C23H28ClN5O2S and a molecular weight of 474.03 g/mol. Its IUPAC name is 4-chloro-2-[1-(1H-indol-5-ylsulfanyl)piperidin-4-yl]-5-(oxan-3-ylmethylamino)pyridazin-3-one.
| Compound Name | 4-chloro-2-[1-(1H-indol-5-ylsulfanyl)piperidin-4-yl]-5-(oxan-3-ylmethylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 168963473 |
| Molecular Formula | C23H28ClN5O2S |
| Molecular Weight | 474.03 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 4-chloro-2-[1-(1H-indol-5-ylsulfanyl)piperidin-4-yl]-5-(oxan-3-ylmethylamino)pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NCC2CCCOC2)cnn1C1CCN(Sc2ccc3[nH]ccc3c2)CC1 |
| InChI | InChI=1S/C23H28ClN5O2S/c24-22-21(26-13-16-2-1-11-31-15-16)14-27-29(23(22)30)18-6-9-28(10-7-18)32-19-3-4-20-17(12-19)5-8-25-20/h3-5,8,12,14,16,18,25-26H,1-2,6-7,9-11,13,15H2 |
| InChIKey | ZVKQKJUZBOMWNB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.03 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|