C24H31ClN4O2S — CID 168963522
4-chloro-2-[1-(4-cyclopropylphenyl)sulfanylpiperidin-4-yl]-5-(oxan-3-ylmethylamino)pyridazin-3-one (PubChem CID 168963522) has the molecular formula C24H31ClN4O2S and a molecular weight of 475.06 g/mol. Its IUPAC name is 4-chloro-2-[1-(4-cyclopropylphenyl)sulfanylpiperidin-4-yl]-5-(oxan-3-ylmethylamino)pyridazin-3-one.
| Compound Name | 4-chloro-2-[1-(4-cyclopropylphenyl)sulfanylpiperidin-4-yl]-5-(oxan-3-ylmethylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 168963522 |
| Molecular Formula | C24H31ClN4O2S |
| Molecular Weight | 475.06 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 4-chloro-2-[1-(4-cyclopropylphenyl)sulfanylpiperidin-4-yl]-5-(oxan-3-ylmethylamino)pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NCC2CCCOC2)cnn1C1CCN(Sc2ccc(C3CC3)cc2)CC1 |
| InChI | InChI=1S/C24H31ClN4O2S/c25-23-22(26-14-17-2-1-13-31-16-17)15-27-29(24(23)30)20-9-11-28(12-10-20)32-21-7-5-19(6-8-21)18-3-4-18/h5-8,15,17-18,20,26H,1-4,9-14,16H2 |
| InChIKey | VNJKUCUQQHGLFB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.06 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|