C21H25ClN6O2S — CID 168964261
5-[4-[5-chloro-4-(oxan-3-ylmethylamino)-6-oxopyridazin-1-yl]piperidin-1-yl]sulfanylpyridine-3-carbonitrile (PubChem CID 168964261) has the molecular formula C21H25ClN6O2S and a molecular weight of 460.99 g/mol. Its IUPAC name is 5-[4-[5-chloro-4-(oxan-3-ylmethylamino)-6-oxopyridazin-1-yl]piperidin-1-yl]sulfanylpyridine-3-carbonitrile.
| Compound Name | 5-[4-[5-chloro-4-(oxan-3-ylmethylamino)-6-oxopyridazin-1-yl]piperidin-1-yl]sulfanylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168964261 |
| Molecular Formula | C21H25ClN6O2S |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 5-[4-[5-chloro-4-(oxan-3-ylmethylamino)-6-oxopyridazin-1-yl]piperidin-1-yl]sulfanylpyridine-3-carbonitrile |
| SMILES | N#Cc1cncc(SN2CCC(n3ncc(NCC4CCCOC4)c(Cl)c3=O)CC2)c1 |
| InChI | InChI=1S/C21H25ClN6O2S/c22-20-19(25-11-15-2-1-7-30-14-15)13-26-28(21(20)29)17-3-5-27(6-4-17)31-18-8-16(9-23)10-24-12-18/h8,10,12-13,15,17,25H,1-7,11,14H2 |
| InChIKey | KRCUZSAMKGPIBQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|