C21H26ClN5O6S — CID 168963516
4-chloro-2-[1-(3-nitrophenyl)sulfonylpiperidin-4-yl]-5-[[(3R)-oxan-3-yl]methylamino]pyridazin-3-one (PubChem CID 168963516) has the molecular formula C21H26ClN5O6S and a molecular weight of 511.99 g/mol. Its IUPAC name is 4-chloro-2-[1-(3-nitrophenyl)sulfonylpiperidin-4-yl]-5-[[(3R)-oxan-3-yl]methylamino]pyridazin-3-one.
| Compound Name | 4-chloro-2-[1-(3-nitrophenyl)sulfonylpiperidin-4-yl]-5-[[(3R)-oxan-3-yl]methylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 168963516 |
| Molecular Formula | C21H26ClN5O6S |
| Molecular Weight | 511.99 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 4-chloro-2-[1-(3-nitrophenyl)sulfonylpiperidin-4-yl]-5-[[(3R)-oxan-3-yl]methylamino]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NC[C@H]2CCCOC2)cnn1C1CCN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C21H26ClN5O6S/c22-20-19(23-12-15-3-2-10-33-14-15)13-24-26(21(20)28)16-6-8-25(9-7-16)34(31,32)18-5-1-4-17(11-18)27(29)30/h1,4-5,11,13,15-16,23H,2-3,6-10,12,14H2/t15-/m1/s1 |
| InChIKey | ASQOMJAPEDLBOF-OAHLLOKOSA-N |
| XLogP | 2.67 |
| TPSA | 136.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.99 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|