C15H13Cl2N5O — CID 133280925
4-chloro-2-(4-chlorophenyl)-5-(2-pyrazol-1-ylethylamino)pyridazin-3-one (PubChem CID 133280925) has the molecular formula C15H13Cl2N5O and a molecular weight of 350.21 g/mol. Its IUPAC name is 4-chloro-2-(4-chlorophenyl)-5-(2-pyrazol-1-ylethylamino)pyridazin-3-one.
| Compound Name | 4-chloro-2-(4-chlorophenyl)-5-(2-pyrazol-1-ylethylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 133280925 |
| Molecular Formula | C15H13Cl2N5O |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 4-chloro-2-(4-chlorophenyl)-5-(2-pyrazol-1-ylethylamino)pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NCCn2cccn2)cnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13Cl2N5O/c16-11-2-4-12(5-3-11)22-15(23)14(17)13(10-20-22)18-7-9-21-8-1-6-19-21/h1-6,8,10,18H,7,9H2 |
| InChIKey | BLWHFSLMVGQUMS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |