C16H22ClN5O3S — CID 55955481
1-(3-chlorophenyl)-N-[3-[ethyl(methylsulfonyl)amino]propyl]-5-methyltriazole-4-carboxamide (PubChem CID 55955481) has the molecular formula C16H22ClN5O3S and a molecular weight of 399.90 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[3-[ethyl(methylsulfonyl)amino]propyl]-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-[3-[ethyl(methylsulfonyl)amino]propyl]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 55955481 |
| Molecular Formula | C16H22ClN5O3S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[3-[ethyl(methylsulfonyl)amino]propyl]-5-methyltriazole-4-carboxamide |
| SMILES | CCN(CCCNC(=O)c1nnn(-c2cccc(Cl)c2)c1C)S(C)(=O)=O |
| InChI | InChI=1S/C16H22ClN5O3S/c1-4-21(26(3,24)25)10-6-9-18-16(23)15-12(2)22(20-19-15)14-8-5-7-13(17)11-14/h5,7-8,11H,4,6,9-10H2,1-3H3,(H,18,23) |
| InChIKey | VJKVOTGDVOACFL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|