C23H24ClN5O2 — CID 86938702
1-(3-chlorophenyl)-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-5-methyltriazole-4-carboxamide (PubChem CID 86938702) has the molecular formula C23H24ClN5O2 and a molecular weight of 437.93 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 86938702 |
| Molecular Formula | C23H24ClN5O2 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCCC(=O)N2CCc3ccccc3C2)nnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H24ClN5O2/c1-16-22(26-27-29(16)20-9-4-8-19(24)14-20)23(31)25-12-5-10-21(30)28-13-11-17-6-2-3-7-18(17)15-28/h2-4,6-9,14H,5,10-13,15H2,1H3,(H,25,31) |
| InChIKey | SGIMDDMDQPVULP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|