C14H18ClN5O — CID 46858045
1-(3-chlorophenyl)-N-[2-(dimethylamino)ethyl]-5-methyltriazole-4-carboxamide (PubChem CID 46858045) has the molecular formula C14H18ClN5O and a molecular weight of 307.79 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[2-(dimethylamino)ethyl]-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-[2-(dimethylamino)ethyl]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 46858045 |
| Molecular Formula | C14H18ClN5O |
| Molecular Weight | 307.79 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[2-(dimethylamino)ethyl]-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCN(C)C)nnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H18ClN5O/c1-10-13(14(21)16-7-8-19(2)3)17-18-20(10)12-6-4-5-11(15)9-12/h4-6,9H,7-8H2,1-3H3,(H,16,21) |
| InChIKey | BRDZJFJVGHKXBT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.79 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |