C17H21ClN4O3 — CID 97100019
ethyl (2S)-2-[[1-(3-chlorophenyl)-5-methyltriazole-4-carbonyl]amino]-3-methylbutanoate (PubChem CID 97100019) has the molecular formula C17H21ClN4O3 and a molecular weight of 364.83 g/mol. Its IUPAC name is ethyl (2S)-2-[[1-(3-chlorophenyl)-5-methyltriazole-4-carbonyl]amino]-3-methylbutanoate.
| Compound Name | ethyl (2S)-2-[[1-(3-chlorophenyl)-5-methyltriazole-4-carbonyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 97100019 |
| Molecular Formula | C17H21ClN4O3 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | ethyl (2S)-2-[[1-(3-chlorophenyl)-5-methyltriazole-4-carbonyl]amino]-3-methylbutanoate |
| SMILES | CCOC(=O)[C@@H](NC(=O)c1nnn(-c2cccc(Cl)c2)c1C)C(C)C |
| InChI | InChI=1S/C17H21ClN4O3/c1-5-25-17(24)14(10(2)3)19-16(23)15-11(4)22(21-20-15)13-8-6-7-12(18)9-13/h6-10,14H,5H2,1-4H3,(H,19,23)/t14-/m0/s1 |
| InChIKey | OLDJVIUSYOECDA-AWEZNQCLSA-N |
| XLogP | 2.55 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |