C17H16ClN5O — CID 40899499
5-amino-1-(3-chlorophenyl)-N-[(1S)-1-phenylethyl]triazole-4-carboxamide (PubChem CID 40899499) has the molecular formula C17H16ClN5O and a molecular weight of 341.80 g/mol. Its IUPAC name is 5-amino-1-(3-chlorophenyl)-N-[(1S)-1-phenylethyl]triazole-4-carboxamide.
| Compound Name | 5-amino-1-(3-chlorophenyl)-N-[(1S)-1-phenylethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 40899499 |
| Molecular Formula | C17H16ClN5O |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 5-amino-1-(3-chlorophenyl)-N-[(1S)-1-phenylethyl]triazole-4-carboxamide |
| SMILES | C[C@H](NC(=O)c1nnn(-c2cccc(Cl)c2)c1N)c1ccccc1 |
| InChI | InChI=1S/C17H16ClN5O/c1-11(12-6-3-2-4-7-12)20-17(24)15-16(19)23(22-21-15)14-9-5-8-13(18)10-14/h2-11H,19H2,1H3,(H,20,24)/t11-/m0/s1 |
| InChIKey | SAXFFFYVRRYESB-NSHDSACASA-N |
| XLogP | 2.99 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |