C17H19ClN4O3 — CID 86840840
ethyl 2-[[1-(3-chlorophenyl)-5-methyltriazole-4-carbonyl]-cyclopropylamino]acetate (PubChem CID 86840840) has the molecular formula C17H19ClN4O3 and a molecular weight of 362.82 g/mol. Its IUPAC name is ethyl 2-[[1-(3-chlorophenyl)-5-methyltriazole-4-carbonyl]-cyclopropylamino]acetate.
| Compound Name | ethyl 2-[[1-(3-chlorophenyl)-5-methyltriazole-4-carbonyl]-cyclopropylamino]acetate |
|---|---|
| PubChem CID | 86840840 |
| Molecular Formula | C17H19ClN4O3 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | ethyl 2-[[1-(3-chlorophenyl)-5-methyltriazole-4-carbonyl]-cyclopropylamino]acetate |
| SMILES | CCOC(=O)CN(C(=O)c1nnn(-c2cccc(Cl)c2)c1C)C1CC1 |
| InChI | InChI=1S/C17H19ClN4O3/c1-3-25-15(23)10-21(13-7-8-13)17(24)16-11(2)22(20-19-16)14-6-4-5-12(18)9-14/h4-6,9,13H,3,7-8,10H2,1-2H3 |
| InChIKey | OCJXHELPKDJWCW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |