C15H17Cl2NO3 — CID 61410087
ethyl 2-[cyclopropyl-[2-(2,6-dichlorophenyl)acetyl]amino]acetate (PubChem CID 61410087) has the molecular formula C15H17Cl2NO3 and a molecular weight of 330.21 g/mol. Its IUPAC name is ethyl 2-[cyclopropyl-[2-(2,6-dichlorophenyl)acetyl]amino]acetate.
| Compound Name | ethyl 2-[cyclopropyl-[2-(2,6-dichlorophenyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 61410087 |
| Molecular Formula | C15H17Cl2NO3 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | ethyl 2-[cyclopropyl-[2-(2,6-dichlorophenyl)acetyl]amino]acetate |
| SMILES | CCOC(=O)CN(C(=O)Cc1c(Cl)cccc1Cl)C1CC1 |
| InChI | InChI=1S/C15H17Cl2NO3/c1-2-21-15(20)9-18(10-6-7-10)14(19)8-11-12(16)4-3-5-13(11)17/h3-5,10H,2,6-9H2,1H3 |
| InChIKey | NSOIMRIVNOOKKZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |