C15H17ClFNO3 — CID 61410393
ethyl 2-[[2-(2-chloro-6-fluorophenyl)acetyl]-cyclopropylamino]acetate (PubChem CID 61410393) has the molecular formula C15H17ClFNO3 and a molecular weight of 313.76 g/mol. Its IUPAC name is ethyl 2-[[2-(2-chloro-6-fluorophenyl)acetyl]-cyclopropylamino]acetate.
| Compound Name | ethyl 2-[[2-(2-chloro-6-fluorophenyl)acetyl]-cyclopropylamino]acetate |
|---|---|
| PubChem CID | 61410393 |
| Molecular Formula | C15H17ClFNO3 |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | ethyl 2-[[2-(2-chloro-6-fluorophenyl)acetyl]-cyclopropylamino]acetate |
| SMILES | CCOC(=O)CN(C(=O)Cc1c(F)cccc1Cl)C1CC1 |
| InChI | InChI=1S/C15H17ClFNO3/c1-2-21-15(20)9-18(10-6-7-10)14(19)8-11-12(16)4-3-5-13(11)17/h3-5,10H,2,6-9H2,1H3 |
| InChIKey | QFQGEGLYHIBGSA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |