C15H18ClNO3S — CID 61410210
ethyl 2-[[2-(4-chlorophenyl)sulfanylacetyl]-cyclopropylamino]acetate (PubChem CID 61410210) has the molecular formula C15H18ClNO3S and a molecular weight of 327.83 g/mol. Its IUPAC name is ethyl 2-[[2-(4-chlorophenyl)sulfanylacetyl]-cyclopropylamino]acetate.
| Compound Name | ethyl 2-[[2-(4-chlorophenyl)sulfanylacetyl]-cyclopropylamino]acetate |
|---|---|
| PubChem CID | 61410210 |
| Molecular Formula | C15H18ClNO3S |
| Molecular Weight | 327.83 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | ethyl 2-[[2-(4-chlorophenyl)sulfanylacetyl]-cyclopropylamino]acetate |
| SMILES | CCOC(=O)CN(C(=O)CSc1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C15H18ClNO3S/c1-2-20-15(19)9-17(12-5-6-12)14(18)10-21-13-7-3-11(16)4-8-13/h3-4,7-8,12H,2,5-6,9-10H2,1H3 |
| InChIKey | JVXQTUHRFCVXLW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.83 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |